C30H56OSiSn — CID 134950737
[(Z)-3-phenyl-2-tributylstannylprop-2-enoxy]-tri(propan-2-yl)silane (PubChem CID 134950737) has the molecular formula C30H56OSiSn and a molecular weight of 579.57 g/mol. Its IUPAC name is [(Z)-3-phenyl-2-tributylstannylprop-2-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(Z)-3-phenyl-2-tributylstannylprop-2-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134950737 |
| Molecular Formula | C30H56OSiSn |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | [(Z)-3-phenyl-2-tributylstannylprop-2-enoxy]-tri(propan-2-yl)silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\c1ccccc1)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29OSi.3C4H9.Sn/c1-15(2)20(16(3)4,17(5)6)19-14-10-13-18-11-8-7-9-12-18;3*1-3-4-2;/h7-9,11-13,15-17H,14H2,1-6H3;3*1,3-4H2,2H3; |
| InChIKey | VBXDCZVKOIRKHY-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|