C31H56SiSn — CID 177407305
trimethyl-[(1Z,3Z)-1-phenyl-2-tributylstannyldeca-1,3-dien-3-yl]silane (PubChem CID 177407305) has the molecular formula C31H56SiSn and a molecular weight of 575.59 g/mol. Its IUPAC name is trimethyl-[(1Z,3Z)-1-phenyl-2-tributylstannyldeca-1,3-dien-3-yl]silane.
| Compound Name | trimethyl-[(1Z,3Z)-1-phenyl-2-tributylstannyldeca-1,3-dien-3-yl]silane |
|---|---|
| PubChem CID | 177407305 |
| Molecular Formula | C31H56SiSn |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | trimethyl-[(1Z,3Z)-1-phenyl-2-tributylstannyldeca-1,3-dien-3-yl]silane |
| SMILES | CCCCCC/C=C(C(=C/c1ccccc1)/[Sn](CCCC)(CCCC)CCCC)\[Si](C)(C)C |
| InChI | InChI=1S/C19H29Si.3C4H9.Sn/c1-5-6-7-8-12-15-19(20(2,3)4)17-16-18-13-10-9-11-14-18;3*1-3-4-2;/h9-11,13-16H,5-8,12H2,1-4H3;3*1,3-4H2,2H3;/b17-16?,19-15-;;;; |
| InChIKey | BRDRBKCPAULBKH-DQILKSDISA-N |
| XLogP | 11.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|