C31H46O3SSn — CID 57326464
[(E,3E)-3-(benzenesulfonylmethylidene)-5-methoxy-1-phenylpent-1-en-2-yl]-tributylstannane (PubChem CID 57326464) has the molecular formula C31H46O3SSn and a molecular weight of 617.48 g/mol. Its IUPAC name is [(E,3E)-3-(benzenesulfonylmethylidene)-5-methoxy-1-phenylpent-1-en-2-yl]-tributylstannane.
| Compound Name | [(E,3E)-3-(benzenesulfonylmethylidene)-5-methoxy-1-phenylpent-1-en-2-yl]-tributylstannane |
|---|---|
| PubChem CID | 57326464 |
| Molecular Formula | C31H46O3SSn |
| Molecular Weight | 617.48 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | [(E,3E)-3-(benzenesulfonylmethylidene)-5-methoxy-1-phenylpent-1-en-2-yl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(=C/c1ccccc1)/C(=C/S(=O)(=O)c1ccccc1)CCOC |
| InChI | InChI=1S/C19H19O3S.3C4H9.Sn/c1-22-15-14-18(13-12-17-8-4-2-5-9-17)16-23(20,21)19-10-6-3-7-11-19;3*1-3-4-2;/h2-12,16H,14-15H2,1H3;3*1,3-4H2,2H3;/b13-12?,18-16-;;;; |
| InChIKey | FGLDJACUZHZEMG-PDTOEZGLSA-N |
| XLogP | 8.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.48 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|