C29H54OSiSn — CID 177480372
tert-butyl-dimethyl-[(Z)-5-phenyl-4-tributylstannylpent-4-enoxy]silane (PubChem CID 177480372) has the molecular formula C29H54OSiSn and a molecular weight of 565.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-5-phenyl-4-tributylstannylpent-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z)-5-phenyl-4-tributylstannylpent-4-enoxy]silane |
|---|---|
| PubChem CID | 177480372 |
| Molecular Formula | C29H54OSiSn |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-5-phenyl-4-tributylstannylpent-4-enoxy]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\c1ccccc1)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H27OSi.3C4H9.Sn/c1-17(2,3)19(4,5)18-15-11-7-10-14-16-12-8-6-9-13-16;3*1-3-4-2;/h6,8-9,12-14H,7,11,15H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | RBQJCMHZZWOTLF-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|