C29H58O2SiSn — CID 10973945
(E)-5-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-3-tributylstannylpent-2-en-1-one (PubChem CID 10973945) has the molecular formula C29H58O2SiSn and a molecular weight of 585.58 g/mol. Its IUPAC name is (E)-5-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-3-tributylstannylpent-2-en-1-one.
| Compound Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-3-tributylstannylpent-2-en-1-one |
|---|---|
| PubChem CID | 10973945 |
| Molecular Formula | C29H58O2SiSn |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-3-tributylstannylpent-2-en-1-one |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/C(=O)C1CCCCC1)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H31O2Si.3C4H9.Sn/c1-17(2,3)20(4,5)19-14-10-9-13-16(18)15-11-7-6-8-12-15;3*1-3-4-2;/h13,15H,6-8,10-12,14H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | ZHVJUIBUMZJZFW-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|