C17H37NO2SiSn — CID 139263783
(Z)-6-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-3-trimethylstannylhex-2-enamide (PubChem CID 139263783) has the molecular formula C17H37NO2SiSn and a molecular weight of 434.29 g/mol. Its IUPAC name is (Z)-6-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-3-trimethylstannylhex-2-enamide.
| Compound Name | (Z)-6-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-3-trimethylstannylhex-2-enamide |
|---|---|
| PubChem CID | 139263783 |
| Molecular Formula | C17H37NO2SiSn |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (Z)-6-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethyl-3-trimethylstannylhex-2-enamide |
| SMILES | CN(C)C(=O)/C=C(/CCCO[Si](C)(C)C(C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C14H28NO2Si.3CH3.Sn/c1-14(2,3)18(6,7)17-12-10-8-9-11-13(16)15(4)5;;;;/h11H,8,10,12H2,1-7H3;3*1H3; |
| InChIKey | HYLAEPRTGPTUSL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|