C11H25NO3Si — CID 87451074
3-[tert-butyl(dimethyl)silyl]oxypropyl-methylcarbamic acid (PubChem CID 87451074) has the molecular formula C11H25NO3Si and a molecular weight of 247.41 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypropyl-methylcarbamic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl-methylcarbamic acid |
|---|---|
| PubChem CID | 87451074 |
| Molecular Formula | C11H25NO3Si |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl-methylcarbamic acid |
| SMILES | CN(CCCO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H25NO3Si/c1-11(2,3)16(5,6)15-9-7-8-12(4)10(13)14/h7-9H2,1-6H3,(H,13,14) |
| InChIKey | DHKNVAXRRUKUIQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|