C18H33NO6Si — CID 25214922
diethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-oxoethylidene]propanedioate (PubChem CID 25214922) has the molecular formula C18H33NO6Si and a molecular weight of 387.55 g/mol. Its IUPAC name is diethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-oxoethylidene]propanedioate.
| Compound Name | diethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-oxoethylidene]propanedioate |
|---|---|
| PubChem CID | 25214922 |
| Molecular Formula | C18H33NO6Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | diethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl-methylamino]-2-oxoethylidene]propanedioate |
| SMILES | CCOC(=O)C(=CC(=O)N(C)CCO[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H33NO6Si/c1-9-23-16(21)14(17(22)24-10-2)13-15(20)19(6)11-12-25-26(7,8)18(3,4)5/h13H,9-12H2,1-8H3 |
| InChIKey | IIEAOWLUSSWXFR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|