C22H34ClNO5Si — CID 139604275
diethyl 2-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-chloroanilino]methylidene]propanedioate (PubChem CID 139604275) has the molecular formula C22H34ClNO5Si and a molecular weight of 456.06 g/mol. Its IUPAC name is diethyl 2-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-chloroanilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-chloroanilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 139604275 |
| Molecular Formula | C22H34ClNO5Si |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | diethyl 2-[[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-chloroanilino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cccc(Cl)c1CCO[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C22H34ClNO5Si/c1-8-27-20(25)17(21(26)28-9-2)15-24-19-12-10-11-18(23)16(19)13-14-29-30(6,7)22(3,4)5/h10-12,15,24H,8-9,13-14H2,1-7H3 |
| InChIKey | CXZGKZAVTOZSDT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|