C13H15BrN2O4 — CID 137391073
diethyl 2-[[(3-bromo-4-pyridinyl)amino]methylidene]propanedioate (PubChem CID 137391073) has the molecular formula C13H15BrN2O4 and a molecular weight of 343.18 g/mol. Its IUPAC name is diethyl 2-[[(3-bromo-4-pyridinyl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(3-bromo-4-pyridinyl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 137391073 |
| Molecular Formula | C13H15BrN2O4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | diethyl 2-[[(3-bromo-4-pyridinyl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ccncc1Br)C(=O)OCC |
| InChI | InChI=1S/C13H15BrN2O4/c1-3-19-12(17)9(13(18)20-4-2)7-16-11-5-6-15-8-10(11)14/h5-8H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | MIZOIMFLKZMRAL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|