C16H19FN2O5 — CID 70418167
diethyl 2-[(5-acetamido-2-fluoroanilino)methylidene]propanedioate (PubChem CID 70418167) has the molecular formula C16H19FN2O5 and a molecular weight of 338.34 g/mol. Its IUPAC name is diethyl 2-[(5-acetamido-2-fluoroanilino)methylidene]propanedioate.
| Compound Name | diethyl 2-[(5-acetamido-2-fluoroanilino)methylidene]propanedioate |
|---|---|
| PubChem CID | 70418167 |
| Molecular Formula | C16H19FN2O5 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | diethyl 2-[(5-acetamido-2-fluoroanilino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cc(NC(C)=O)ccc1F)C(=O)OCC |
| InChI | InChI=1S/C16H19FN2O5/c1-4-23-15(21)12(16(22)24-5-2)9-18-14-8-11(19-10(3)20)6-7-13(14)17/h6-9,18H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | RQQICWXDOMCKST-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|