C14H15F2NO5 — CID 5338334
diethyl 2-[(3,4-difluoro-2-hydroxyanilino)methylidene]propanedioate (PubChem CID 5338334) has the molecular formula C14H15F2NO5 and a molecular weight of 315.27 g/mol. Its IUPAC name is diethyl 2-[(3,4-difluoro-2-hydroxyanilino)methylidene]propanedioate.
| Compound Name | diethyl 2-[(3,4-difluoro-2-hydroxyanilino)methylidene]propanedioate |
|---|---|
| PubChem CID | 5338334 |
| Molecular Formula | C14H15F2NO5 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | diethyl 2-[(3,4-difluoro-2-hydroxyanilino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ccc(F)c(F)c1O)C(=O)OCC |
| InChI | InChI=1S/C14H15F2NO5/c1-3-21-13(19)8(14(20)22-4-2)7-17-10-6-5-9(15)11(16)12(10)18/h5-7,17-18H,3-4H2,1-2H3 |
| InChIKey | LWFLJWNPMIQDQZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|