C20H24F3NO7 — CID 7084315
diethyl 2-[[4-[(2S)-3-ethoxy-1,1,1-trifluoro-2-hydroxy-3-oxopropan-2-yl]-2-methylanilino]methylidene]propanedioate (PubChem CID 7084315) has the molecular formula C20H24F3NO7 and a molecular weight of 447.41 g/mol. Its IUPAC name is diethyl 2-[[4-[(2S)-3-ethoxy-1,1,1-trifluoro-2-hydroxy-3-oxopropan-2-yl]-2-methylanilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[4-[(2S)-3-ethoxy-1,1,1-trifluoro-2-hydroxy-3-oxopropan-2-yl]-2-methylanilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 7084315 |
| Molecular Formula | C20H24F3NO7 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | diethyl 2-[[4-[(2S)-3-ethoxy-1,1,1-trifluoro-2-hydroxy-3-oxopropan-2-yl]-2-methylanilino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ccc([C@](O)(C(=O)OCC)C(F)(F)F)cc1C)C(=O)OCC |
| InChI | InChI=1S/C20H24F3NO7/c1-5-29-16(25)14(17(26)30-6-2)11-24-15-9-8-13(10-12(15)4)19(28,20(21,22)23)18(27)31-7-3/h8-11,24,28H,5-7H2,1-4H3/t19-/m0/s1 |
| InChIKey | IQLYUQNVUYSHJC-IBGZPJMESA-N |
| XLogP | 2.73 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|