C19H18F3NO4 — CID 3492337
ethyl 3,3,3-trifluoro-2-hydroxy-2-[4-[(2-hydroxyphenyl)methylideneamino]-3-methylphenyl]propanoate (PubChem CID 3492337) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-hydroxy-2-[4-[(2-hydroxyphenyl)methylideneamino]-3-methylphenyl]propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-hydroxy-2-[4-[(2-hydroxyphenyl)methylideneamino]-3-methylphenyl]propanoate |
|---|---|
| PubChem CID | 3492337 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-hydroxy-2-[4-[(2-hydroxyphenyl)methylideneamino]-3-methylphenyl]propanoate |
| SMILES | CCOC(=O)C(O)(c1ccc(/N=C/c2ccccc2O)c(C)c1)C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO4/c1-3-27-17(25)18(26,19(20,21)22)14-8-9-15(12(2)10-14)23-11-13-6-4-5-7-16(13)24/h4-11,24,26H,3H2,1-2H3/b23-11+ |
| InChIKey | UGAPZYQYIXSBCE-FOKLQQMPSA-N |
| XLogP | 3.76 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|