C15H13F3O3 — CID 12060174
ethyl 3,3,3-trifluoro-2-hydroxy-2-naphthalen-1-ylpropanoate (PubChem CID 12060174) has the molecular formula C15H13F3O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-hydroxy-2-naphthalen-1-ylpropanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-hydroxy-2-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 12060174 |
| Molecular Formula | C15H13F3O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-hydroxy-2-naphthalen-1-ylpropanoate |
| SMILES | CCOC(=O)C(O)(c1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C15H13F3O3/c1-2-21-13(19)14(20,15(16,17)18)12-9-5-7-10-6-3-4-8-11(10)12/h3-9,20H,2H2,1H3 |
| InChIKey | OPSBKMGLRIUPJF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |