C20H21NO4 — CID 54438257
diethyl 2-(cyanomethyl)-2-(naphthalen-1-ylmethyl)propanedioate (PubChem CID 54438257) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is diethyl 2-(cyanomethyl)-2-(naphthalen-1-ylmethyl)propanedioate.
| Compound Name | diethyl 2-(cyanomethyl)-2-(naphthalen-1-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 54438257 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | diethyl 2-(cyanomethyl)-2-(naphthalen-1-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(CC#N)(Cc1cccc2ccccc12)C(=O)OCC |
| InChI | InChI=1S/C20H21NO4/c1-3-24-18(22)20(12-13-21,19(23)25-4-2)14-16-10-7-9-15-8-5-6-11-17(15)16/h5-11H,3-4,12,14H2,1-2H3 |
| InChIKey | WMGFCTRUMNHLBC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|