C20H27BrO4Si — CID 14713451
diethyl 2-[(2-bromophenyl)methyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate (PubChem CID 14713451) has the molecular formula C20H27BrO4Si and a molecular weight of 439.42 g/mol. Its IUPAC name is diethyl 2-[(2-bromophenyl)methyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate.
| Compound Name | diethyl 2-[(2-bromophenyl)methyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
|---|---|
| PubChem CID | 14713451 |
| Molecular Formula | C20H27BrO4Si |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | diethyl 2-[(2-bromophenyl)methyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
| SMILES | CCOC(=O)C(CC#C[Si](C)(C)C)(Cc1ccccc1Br)C(=O)OCC |
| InChI | InChI=1S/C20H27BrO4Si/c1-6-24-18(22)20(19(23)25-7-2,13-10-14-26(3,4)5)15-16-11-8-9-12-17(16)21/h8-9,11-12H,6-7,13,15H2,1-5H3 |
| InChIKey | RJYIGHGLTJQFGG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|