C16H18O4 — CID 103974517
2-ethoxycarbonyl-2-ethyl-5-phenylpent-4-ynoic acid (PubChem CID 103974517) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-ethyl-5-phenylpent-4-ynoic acid.
| Compound Name | 2-ethoxycarbonyl-2-ethyl-5-phenylpent-4-ynoic acid |
|---|---|
| PubChem CID | 103974517 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-ethoxycarbonyl-2-ethyl-5-phenylpent-4-ynoic acid |
| SMILES | CCOC(=O)C(CC)(CC#Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H18O4/c1-3-16(14(17)18,15(19)20-4-2)12-8-11-13-9-6-5-7-10-13/h5-7,9-10H,3-4,12H2,1-2H3,(H,17,18) |
| InChIKey | FTKQXFKFIIVTTA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|