C34H32N2O7 — CID 139254329
1-[2-[4,4-bis(ethoxycarbonyl)-7-phenylhepta-1,6-diynyl]phenyl]-N-[(1S)-1-(4-nitrophenyl)ethyl]methanimine oxide (PubChem CID 139254329) has the molecular formula C34H32N2O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is 1-[2-[4,4-bis(ethoxycarbonyl)-7-phenylhepta-1,6-diynyl]phenyl]-N-[(1S)-1-(4-nitrophenyl)ethyl]methanimine oxide.
| Compound Name | 1-[2-[4,4-bis(ethoxycarbonyl)-7-phenylhepta-1,6-diynyl]phenyl]-N-[(1S)-1-(4-nitrophenyl)ethyl]methanimine oxide |
|---|---|
| PubChem CID | 139254329 |
| Molecular Formula | C34H32N2O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | 1-[2-[4,4-bis(ethoxycarbonyl)-7-phenylhepta-1,6-diynyl]phenyl]-N-[(1S)-1-(4-nitrophenyl)ethyl]methanimine oxide |
| SMILES | CCOC(=O)C(CC#Cc1ccccc1)(CC#Cc1ccccc1/C=[N+](\[O-])[C@@H](C)c1ccc([N+](=O)[O-])cc1)C(=O)OCC |
| InChI | InChI=1S/C34H32N2O7/c1-4-42-32(37)34(33(38)43-5-2,23-11-15-27-13-7-6-8-14-27)24-12-18-29-16-9-10-17-30(29)25-35(39)26(3)28-19-21-31(22-20-28)36(40)41/h6-10,13-14,16-17,19-22,25-26H,4-5,23-24H2,1-3H3/b35-25-/t26-/m0/s1 |
| InChIKey | BJFKDGMAFOYWPO-DYRFDQPQSA-N |
| XLogP | 5.58 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|