C24H28O5 — CID 101374885
diethyl 2-(4,4-dimethylpent-2-ynyl)-2-[3-(2-formylphenyl)prop-2-ynyl]propanedioate (PubChem CID 101374885) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is diethyl 2-(4,4-dimethylpent-2-ynyl)-2-[3-(2-formylphenyl)prop-2-ynyl]propanedioate.
| Compound Name | diethyl 2-(4,4-dimethylpent-2-ynyl)-2-[3-(2-formylphenyl)prop-2-ynyl]propanedioate |
|---|---|
| PubChem CID | 101374885 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | diethyl 2-(4,4-dimethylpent-2-ynyl)-2-[3-(2-formylphenyl)prop-2-ynyl]propanedioate |
| SMILES | CCOC(=O)C(CC#Cc1ccccc1C=O)(CC#CC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C24H28O5/c1-6-28-21(26)24(22(27)29-7-2,17-11-15-23(3,4)5)16-10-14-19-12-8-9-13-20(19)18-25/h8-9,12-13,18H,6-7,16-17H2,1-5H3 |
| InChIKey | QUKLSCWUQRNKRH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|