C32H37NO5 — CID 139254357
1-[2-[4,4-bis(ethoxycarbonyl)hept-6-en-1-ynyl]phenyl]-N-[(1S,2R)-2-phenylcyclohexyl]methanimine oxide (PubChem CID 139254357) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is 1-[2-[4,4-bis(ethoxycarbonyl)hept-6-en-1-ynyl]phenyl]-N-[(1S,2R)-2-phenylcyclohexyl]methanimine oxide.
| Compound Name | 1-[2-[4,4-bis(ethoxycarbonyl)hept-6-en-1-ynyl]phenyl]-N-[(1S,2R)-2-phenylcyclohexyl]methanimine oxide |
|---|---|
| PubChem CID | 139254357 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | 1-[2-[4,4-bis(ethoxycarbonyl)hept-6-en-1-ynyl]phenyl]-N-[(1S,2R)-2-phenylcyclohexyl]methanimine oxide |
| SMILES | C=CCC(CC#Cc1ccccc1/C=[N+](\[O-])[C@H]1CCCC[C@@H]1c1ccccc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C32H37NO5/c1-4-22-32(30(34)37-5-2,31(35)38-6-3)23-14-19-25-15-10-11-18-27(25)24-33(36)29-21-13-12-20-28(29)26-16-8-7-9-17-26/h4,7-11,15-18,24,28-29H,1,5-6,12-13,20-23H2,2-3H3/b33-24-/t28-,29+/m1/s1 |
| InChIKey | XRTUTAOERLNEFY-OEWCXFKKSA-N |
| XLogP | 5.77 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|