C18H28O4 — CID 102185388
diethyl 2-(5,5-dimethylhex-2-ynyl)-2-prop-2-enylpropanedioate (PubChem CID 102185388) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is diethyl 2-(5,5-dimethylhex-2-ynyl)-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-(5,5-dimethylhex-2-ynyl)-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 102185388 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | diethyl 2-(5,5-dimethylhex-2-ynyl)-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC#CCC(C)(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H28O4/c1-7-12-18(15(19)21-8-2,16(20)22-9-3)14-11-10-13-17(4,5)6/h7H,1,8-9,12-14H2,2-6H3 |
| InChIKey | BCYAGWXJTRKTOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|