C16H22O4 — CID 11022242
diethyl 2-but-2-ynyl-2-[(2E)-penta-2,4-dienyl]propanedioate (PubChem CID 11022242) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is diethyl 2-but-2-ynyl-2-[(2E)-penta-2,4-dienyl]propanedioate.
| Compound Name | diethyl 2-but-2-ynyl-2-[(2E)-penta-2,4-dienyl]propanedioate |
|---|---|
| PubChem CID | 11022242 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | diethyl 2-but-2-ynyl-2-[(2E)-penta-2,4-dienyl]propanedioate |
| SMILES | C=C/C=C/CC(CC#CC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H22O4/c1-5-9-11-13-16(12-10-6-2,14(17)19-7-3)15(18)20-8-4/h5,9,11H,1,7-8,12-13H2,2-4H3/b11-9+ |
| InChIKey | RYOFYJAGZONDKD-PKNBQFBNSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|