C14H18F2O4 — CID 102055412
diethyl 2-but-2-ynyl-2-(3,3-difluoroprop-2-enyl)propanedioate (PubChem CID 102055412) has the molecular formula C14H18F2O4 and a molecular weight of 288.29 g/mol. Its IUPAC name is diethyl 2-but-2-ynyl-2-(3,3-difluoroprop-2-enyl)propanedioate.
| Compound Name | diethyl 2-but-2-ynyl-2-(3,3-difluoroprop-2-enyl)propanedioate |
|---|---|
| PubChem CID | 102055412 |
| Molecular Formula | C14H18F2O4 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | diethyl 2-but-2-ynyl-2-(3,3-difluoroprop-2-enyl)propanedioate |
| SMILES | CC#CCC(CC=C(F)F)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C14H18F2O4/c1-4-7-9-14(10-8-11(15)16,12(17)19-5-2)13(18)20-6-3/h8H,5-6,9-10H2,1-3H3 |
| InChIKey | DZTTXVCIHBXEEG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|