C16H24O4 — CID 15890717
diethyl 2-but-2-ynyl-2-[(E)-pent-2-enyl]propanedioate (PubChem CID 15890717) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is diethyl 2-but-2-ynyl-2-[(E)-pent-2-enyl]propanedioate.
| Compound Name | diethyl 2-but-2-ynyl-2-[(E)-pent-2-enyl]propanedioate |
|---|---|
| PubChem CID | 15890717 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | diethyl 2-but-2-ynyl-2-[(E)-pent-2-enyl]propanedioate |
| SMILES | CC#CCC(C/C=C/CC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H24O4/c1-5-9-11-13-16(12-10-6-2,14(17)19-7-3)15(18)20-8-4/h9,11H,5,7-8,12-13H2,1-4H3/b11-9+ |
| InChIKey | XUKNGZVGJMFRQG-PKNBQFBNSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|