C15H22O4 — CID 10880020
diethyl 2-pent-2-ynyl-2-prop-2-enylpropanedioate (PubChem CID 10880020) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is diethyl 2-pent-2-ynyl-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-pent-2-ynyl-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 10880020 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | diethyl 2-pent-2-ynyl-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC#CCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H22O4/c1-5-9-10-12-15(11-6-2,13(16)18-7-3)14(17)19-8-4/h6H,2,5,7-8,11-12H2,1,3-4H3 |
| InChIKey | DMHRSWXCYYKSPF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|