C19H27IO4 — CID 134835578
diethyl 2-[(Z)-3-iodoprop-2-enyl]-2-(7-methyloct-7-en-2-ynyl)propanedioate (PubChem CID 134835578) has the molecular formula C19H27IO4 and a molecular weight of 446.33 g/mol. Its IUPAC name is diethyl 2-[(Z)-3-iodoprop-2-enyl]-2-(7-methyloct-7-en-2-ynyl)propanedioate.
| Compound Name | diethyl 2-[(Z)-3-iodoprop-2-enyl]-2-(7-methyloct-7-en-2-ynyl)propanedioate |
|---|---|
| PubChem CID | 134835578 |
| Molecular Formula | C19H27IO4 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | diethyl 2-[(Z)-3-iodoprop-2-enyl]-2-(7-methyloct-7-en-2-ynyl)propanedioate |
| SMILES | C=C(C)CCCC#CCC(C/C=C\I)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H27IO4/c1-5-23-17(21)19(14-11-15-20,18(22)24-6-2)13-10-8-7-9-12-16(3)4/h11,15H,3,5-7,9,12-14H2,1-2,4H3/b15-11- |
| InChIKey | ZHUKFEZLRYNPEB-PTNGSMBKSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|