C24H38F2O4Si — CID 101186856
diethyl 2-but-2-ynyl-2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]propanedioate (PubChem CID 101186856) has the molecular formula C24H38F2O4Si and a molecular weight of 456.65 g/mol. Its IUPAC name is diethyl 2-but-2-ynyl-2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]propanedioate.
| Compound Name | diethyl 2-but-2-ynyl-2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]propanedioate |
|---|---|
| PubChem CID | 101186856 |
| Molecular Formula | C24H38F2O4Si |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | diethyl 2-but-2-ynyl-2-[4,4-difluoro-2-tri(propan-2-yl)silylbuta-2,3-dienyl]propanedioate |
| SMILES | CC#CCC(CC(=C=C(F)F)[Si](C(C)C)(C(C)C)C(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H38F2O4Si/c1-10-13-14-24(22(27)29-11-2,23(28)30-12-3)16-20(15-21(25)26)31(17(4)5,18(6)7)19(8)9/h17-19H,11-12,14,16H2,1-9H3 |
| InChIKey | UTGSNDHBEQPXCP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|