C16H24O5 — CID 10063153
diethyl 2-(4-oxobutyl)-2-[(2E)-penta-2,4-dienyl]propanedioate (PubChem CID 10063153) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is diethyl 2-(4-oxobutyl)-2-[(2E)-penta-2,4-dienyl]propanedioate.
| Compound Name | diethyl 2-(4-oxobutyl)-2-[(2E)-penta-2,4-dienyl]propanedioate |
|---|---|
| PubChem CID | 10063153 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | diethyl 2-(4-oxobutyl)-2-[(2E)-penta-2,4-dienyl]propanedioate |
| SMILES | C=C/C=C/CC(CCCC=O)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H24O5/c1-4-7-8-11-16(12-9-10-13-17,14(18)20-5-2)15(19)21-6-3/h4,7-8,13H,1,5-6,9-12H2,2-3H3/b8-7+ |
| InChIKey | BQUDMMPRAZIFNE-BQYQJAHWSA-N |
| XLogP | 2.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|