About diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate
diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate (PubChem CID 10362725) has the molecular formula C23H30O5
and a molecular weight of 386.49 g/mol. Its IUPAC name is diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate |
| PubChem CID | 10362725 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate |
| SMILES | C=C/C=C/CC(C/C=C/COCc1ccccc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H30O5/c1-4-7-11-16-23(21(24)27-5-2,22(25)28-6-3)17-12-13-18-26-19-20-14-9-8-10-15-20/h4,7-15H,1,5-6,16-19H2,2-3H3/b11-7+,13-12+ |
| InChIKey | LZGTYDJPVLETGR-FREZGGHOSA-N |
| XLogP | 4.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate?
The IUPAC name of diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate (CID 10362725) is diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate.
What is the SMILES notation for diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate?
The canonical SMILES for diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate is C=C/C=C/CC(C/C=C/COCc1ccccc1)(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate?
The InChIKey is LZGTYDJPVLETGR-FREZGGHOSA-N. The full InChI is InChI=1S/C23H30O5/c1-4-7-11-16-23(21(24)27-5-2,22(25)28-6-3)17-12-13-18-26-19-20-14-9-8-10-15-20/h4,7-15H,1,5-6,16-19H2,2-3H3/b11-7+,13-12+.
What are the key properties of diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate?
diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate has a molecular weight of 386.49 g/mol, XLogP of 4.39, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(2E)-penta-2,4-dienyl]-2-[(E)-4-phenylmethoxybut-2-enyl]propanedioate is sourced from PubChem (CID 10362725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).