C24H27NO2 — CID 14789884
N-[(3E)-hexa-3,5-dienyl]-N-[(Z)-4-phenylmethoxybut-2-enyl]benzamide (PubChem CID 14789884) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[(3E)-hexa-3,5-dienyl]-N-[(Z)-4-phenylmethoxybut-2-enyl]benzamide.
| Compound Name | N-[(3E)-hexa-3,5-dienyl]-N-[(Z)-4-phenylmethoxybut-2-enyl]benzamide |
|---|---|
| PubChem CID | 14789884 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[(3E)-hexa-3,5-dienyl]-N-[(Z)-4-phenylmethoxybut-2-enyl]benzamide |
| SMILES | C=C/C=C/CCN(C/C=C\COCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO2/c1-2-3-4-11-18-25(24(26)23-16-9-6-10-17-23)19-12-13-20-27-21-22-14-7-5-8-15-22/h2-10,12-17H,1,11,18-21H2/b4-3+,13-12- |
| InChIKey | KHVNZBNWTNTNGV-JPLZDGERSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|