C23H27FO4 — CID 11025483
ethyl (E,3R)-3-fluoro-6-phenylmethoxy-3-(phenylmethoxymethyl)hex-4-enoate (PubChem CID 11025483) has the molecular formula C23H27FO4 and a molecular weight of 386.46 g/mol. Its IUPAC name is ethyl (E,3R)-3-fluoro-6-phenylmethoxy-3-(phenylmethoxymethyl)hex-4-enoate.
| Compound Name | ethyl (E,3R)-3-fluoro-6-phenylmethoxy-3-(phenylmethoxymethyl)hex-4-enoate |
|---|---|
| PubChem CID | 11025483 |
| Molecular Formula | C23H27FO4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | ethyl (E,3R)-3-fluoro-6-phenylmethoxy-3-(phenylmethoxymethyl)hex-4-enoate |
| SMILES | CCOC(=O)C[C@@](F)(/C=C/COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C23H27FO4/c1-2-28-22(25)16-23(24,19-27-18-21-12-7-4-8-13-21)14-9-15-26-17-20-10-5-3-6-11-20/h3-14H,2,15-19H2,1H3/b14-9+/t23-/m0/s1 |
| InChIKey | JVAODSRYWVOCHY-PZVJUEDKSA-N |
| XLogP | 4.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|