C18H26F2O5 — CID 138693919
ethyl 2-[2-(3,3-difluoro-5-phenylmethoxypentoxy)ethoxy]acetate (PubChem CID 138693919) has the molecular formula C18H26F2O5 and a molecular weight of 360.40 g/mol. Its IUPAC name is ethyl 2-[2-(3,3-difluoro-5-phenylmethoxypentoxy)ethoxy]acetate.
| Compound Name | ethyl 2-[2-(3,3-difluoro-5-phenylmethoxypentoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 138693919 |
| Molecular Formula | C18H26F2O5 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl 2-[2-(3,3-difluoro-5-phenylmethoxypentoxy)ethoxy]acetate |
| SMILES | CCOC(=O)COCCOCCC(F)(F)CCOCc1ccccc1 |
| InChI | InChI=1S/C18H26F2O5/c1-2-25-17(21)15-24-13-12-22-10-8-18(19,20)9-11-23-14-16-6-4-3-5-7-16/h3-7H,2,8-15H2,1H3 |
| InChIKey | KHPLRLIKVLGXCA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|