C19H26O12 — CID 158939829
2-[2-(carboxymethoxy)ethoxy]acetic acid;2-[2-(2-oxo-2-phenylmethoxyethoxy)ethoxy]acetic acid (PubChem CID 158939829) has the molecular formula C19H26O12 and a molecular weight of 446.41 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)ethoxy]acetic acid;2-[2-(2-oxo-2-phenylmethoxyethoxy)ethoxy]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)ethoxy]acetic acid;2-[2-(2-oxo-2-phenylmethoxyethoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 158939829 |
| Molecular Formula | C19H26O12 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-[2-(carboxymethoxy)ethoxy]acetic acid;2-[2-(2-oxo-2-phenylmethoxyethoxy)ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCC(=O)O.O=C(O)COCCOCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16O6.C6H10O6/c14-12(15)9-17-6-7-18-10-13(16)19-8-11-4-2-1-3-5-11;7-5(8)3-11-1-2-12-4-6(9)10/h1-5H,6-10H2,(H,14,15);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | JKCMRMVAJPQVCM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 175.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|