C16H22O6 — CID 146657056
4-[2-(3-oxo-3-phenylmethoxypropoxy)ethoxy]butanoic acid (PubChem CID 146657056) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-[2-(3-oxo-3-phenylmethoxypropoxy)ethoxy]butanoic acid.
| Compound Name | 4-[2-(3-oxo-3-phenylmethoxypropoxy)ethoxy]butanoic acid |
|---|---|
| PubChem CID | 146657056 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[2-(3-oxo-3-phenylmethoxypropoxy)ethoxy]butanoic acid |
| SMILES | O=C(O)CCCOCCOCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22O6/c17-15(18)7-4-9-20-11-12-21-10-8-16(19)22-13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2,(H,17,18) |
| InChIKey | DRJHNUFSEYOSKH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|