C25H39NO7S2 — CID 163562316
benzyl 3-[2-[2-[3-[(6-ethoxy-3-oxohexyl)disulfanyl]propanoylamino]ethoxy]ethoxy]propanoate (PubChem CID 163562316) has the molecular formula C25H39NO7S2 and a molecular weight of 529.72 g/mol. Its IUPAC name is benzyl 3-[2-[2-[3-[(6-ethoxy-3-oxohexyl)disulfanyl]propanoylamino]ethoxy]ethoxy]propanoate.
| Compound Name | benzyl 3-[2-[2-[3-[(6-ethoxy-3-oxohexyl)disulfanyl]propanoylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 163562316 |
| Molecular Formula | C25H39NO7S2 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | benzyl 3-[2-[2-[3-[(6-ethoxy-3-oxohexyl)disulfanyl]propanoylamino]ethoxy]ethoxy]propanoate |
| SMILES | CCOCCCC(=O)CCSSCCC(=O)NCCOCCOCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H39NO7S2/c1-2-30-14-6-9-23(27)11-19-34-35-20-12-24(28)26-13-16-32-18-17-31-15-10-25(29)33-21-22-7-4-3-5-8-22/h3-5,7-8H,2,6,9-21H2,1H3,(H,26,28) |
| InChIKey | PVLXXFGPTLAEPJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|