C30H42NO11P — CID 163945395
2-[2-[5-[2-[2-[3-bis(phenylmethoxy)phosphorylpropanoylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid (PubChem CID 163945395) has the molecular formula C30H42NO11P and a molecular weight of 623.64 g/mol. Its IUPAC name is 2-[2-[5-[2-[2-[3-bis(phenylmethoxy)phosphorylpropanoylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[5-[2-[2-[3-bis(phenylmethoxy)phosphorylpropanoylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 163945395 |
| Molecular Formula | C30H42NO11P |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | 2-[2-[5-[2-[2-[3-bis(phenylmethoxy)phosphorylpropanoylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCCC(=O)COCCOCCNC(=O)CCP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H42NO11P/c32-28(12-7-15-37-17-20-40-25-30(34)35)24-39-19-18-38-16-14-31-29(33)13-21-43(36,41-22-26-8-3-1-4-9-26)42-23-27-10-5-2-6-11-27/h1-6,8-11H,7,12-25H2,(H,31,33)(H,34,35) |
| InChIKey | RUQIYSYQDAMYIE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|