C34H46N2O8 — CID 139298687
benzyl 3-[3-[[4-[2-(3-oxo-3-phenylmethoxypropoxy)ethylcarbamoyl]cycloheptanecarbonyl]amino]propoxy]propanoate (PubChem CID 139298687) has the molecular formula C34H46N2O8 and a molecular weight of 610.75 g/mol. Its IUPAC name is benzyl 3-[3-[[4-[2-(3-oxo-3-phenylmethoxypropoxy)ethylcarbamoyl]cycloheptanecarbonyl]amino]propoxy]propanoate.
| Compound Name | benzyl 3-[3-[[4-[2-(3-oxo-3-phenylmethoxypropoxy)ethylcarbamoyl]cycloheptanecarbonyl]amino]propoxy]propanoate |
|---|---|
| PubChem CID | 139298687 |
| Molecular Formula | C34H46N2O8 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | benzyl 3-[3-[[4-[2-(3-oxo-3-phenylmethoxypropoxy)ethylcarbamoyl]cycloheptanecarbonyl]amino]propoxy]propanoate |
| SMILES | O=C(CCOCCCNC(=O)C1CCCC(C(=O)NCCOCCC(=O)OCc2ccccc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C34H46N2O8/c37-31(43-25-27-9-3-1-4-10-27)17-22-41-21-8-19-35-33(39)29-13-7-14-30(16-15-29)34(40)36-20-24-42-23-18-32(38)44-26-28-11-5-2-6-12-28/h1-6,9-12,29-30H,7-8,13-26H2,(H,35,39)(H,36,40) |
| InChIKey | OTVQXRLBZBLEMY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|