C17H25N3O2 — CID 119338181
N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]cyclobutanecarboxamide (PubChem CID 119338181) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 119338181 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]cyclobutanecarboxamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCCCNC(=O)C1CCC1 |
| InChI | InChI=1S/C17H25N3O2/c18-15(12-13-6-2-1-3-7-13)17(22)20-11-5-10-19-16(21)14-8-4-9-14/h1-3,6-7,14-15H,4-5,8-12,18H2,(H,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | AGHGLSZWZPOQJC-HNNXBMFYSA-N |
| XLogP | 0.98 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|