C21H34ClNO10 — CID 157234769
2-[2-(2-aminoethoxy)ethoxy]acetic acid;benzyl carbonochloridate;2-(2-propoxyethoxy)acetic acid (PubChem CID 157234769) has the molecular formula C21H34ClNO10 and a molecular weight of 495.95 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethoxy]acetic acid;benzyl carbonochloridate;2-(2-propoxyethoxy)acetic acid.
| Compound Name | 2-[2-(2-aminoethoxy)ethoxy]acetic acid;benzyl carbonochloridate;2-(2-propoxyethoxy)acetic acid |
|---|---|
| PubChem CID | 157234769 |
| Molecular Formula | C21H34ClNO10 |
| Molecular Weight | 495.95 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethoxy]acetic acid;benzyl carbonochloridate;2-(2-propoxyethoxy)acetic acid |
| SMILES | CCCOCCOCC(=O)O.NCCOCCOCC(=O)O.O=C(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C8H7ClO2.C7H14O4.C6H13NO4/c9-8(10)11-6-7-4-2-1-3-5-7;1-2-3-10-4-5-11-6-7(8)9;7-1-2-10-3-4-11-5-6(8)9/h1-5H,6H2;2-6H2,1H3,(H,8,9);1-5,7H2,(H,8,9) |
| InChIKey | AUMVAWHQLUQPBY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.95 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|