C11H27N2O6+ — CID 142879742
2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid;methylazanium (PubChem CID 142879742) has the molecular formula C11H27N2O6+ and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid;methylazanium.
| Compound Name | 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid;methylazanium |
|---|---|
| PubChem CID | 142879742 |
| Molecular Formula | C11H27N2O6+ |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid;methylazanium |
| SMILES | C[NH3+].NCCOCCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C10H21NO6.CH5N/c11-1-2-14-3-4-15-5-6-16-7-8-17-9-10(12)13;1-2/h1-9,11H2,(H,12,13);2H2,1H3/p+1 |
| InChIKey | BOZUFSCVVVMCPP-UHFFFAOYSA-O |
| XLogP | -2.05 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|