C14H21F2O4P — CID 162539468
(3-diethoxyphosphoryl-3,3-difluoropropoxy)methylbenzene (PubChem CID 162539468) has the molecular formula C14H21F2O4P and a molecular weight of 322.29 g/mol. Its IUPAC name is (3-diethoxyphosphoryl-3,3-difluoropropoxy)methylbenzene.
| Compound Name | (3-diethoxyphosphoryl-3,3-difluoropropoxy)methylbenzene |
|---|---|
| PubChem CID | 162539468 |
| Molecular Formula | C14H21F2O4P |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (3-diethoxyphosphoryl-3,3-difluoropropoxy)methylbenzene |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCOCc1ccccc1 |
| InChI | InChI=1S/C14H21F2O4P/c1-3-19-21(17,20-4-2)14(15,16)10-11-18-12-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3 |
| InChIKey | GNILVYRMAOJWIE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|