C17H28O6P2 — CID 87872148
(4-diethoxyphosphoryl-4-ethoxy-4-phosphorosobutoxy)methylbenzene (PubChem CID 87872148) has the molecular formula C17H28O6P2 and a molecular weight of 390.35 g/mol. Its IUPAC name is (4-diethoxyphosphoryl-4-ethoxy-4-phosphorosobutoxy)methylbenzene.
| Compound Name | (4-diethoxyphosphoryl-4-ethoxy-4-phosphorosobutoxy)methylbenzene |
|---|---|
| PubChem CID | 87872148 |
| Molecular Formula | C17H28O6P2 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (4-diethoxyphosphoryl-4-ethoxy-4-phosphorosobutoxy)methylbenzene |
| SMILES | CCOC(CCCOCc1ccccc1)(P=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H28O6P2/c1-4-21-17(24-18,25(19,22-5-2)23-6-3)13-10-14-20-15-16-11-8-7-9-12-16/h7-9,11-12H,4-6,10,13-15H2,1-3H3 |
| InChIKey | RRAWWQBLAKYULG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|