C20H33O6P — CID 134863694
(4S,5R)-2-diethoxyphosphoryl-5-hydroxy-4-methyl-8-phenylmethoxyoctan-3-one (PubChem CID 134863694) has the molecular formula C20H33O6P and a molecular weight of 400.45 g/mol. Its IUPAC name is (4S,5R)-2-diethoxyphosphoryl-5-hydroxy-4-methyl-8-phenylmethoxyoctan-3-one.
| Compound Name | (4S,5R)-2-diethoxyphosphoryl-5-hydroxy-4-methyl-8-phenylmethoxyoctan-3-one |
|---|---|
| PubChem CID | 134863694 |
| Molecular Formula | C20H33O6P |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (4S,5R)-2-diethoxyphosphoryl-5-hydroxy-4-methyl-8-phenylmethoxyoctan-3-one |
| SMILES | CCOP(=O)(OCC)C(C)C(=O)[C@@H](C)[C@H](O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C20H33O6P/c1-5-25-27(23,26-6-2)17(4)20(22)16(3)19(21)13-10-14-24-15-18-11-8-7-9-12-18/h7-9,11-12,16-17,19,21H,5-6,10,13-15H2,1-4H3/t16-,17?,19+/m0/s1 |
| InChIKey | ZKYXJUAUYWVLRV-LVLJQFTKSA-N |
| XLogP | 4.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|