C13H18O2 — CID 11218003
(2S)-2-methyl-5-phenylmethoxypentanal (PubChem CID 11218003) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (2S)-2-methyl-5-phenylmethoxypentanal.
| Compound Name | (2S)-2-methyl-5-phenylmethoxypentanal |
|---|---|
| PubChem CID | 11218003 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2S)-2-methyl-5-phenylmethoxypentanal |
| SMILES | C[C@H](C=O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-12(10-14)6-5-9-15-11-13-7-3-2-4-8-13/h2-4,7-8,10,12H,5-6,9,11H2,1H3/t12-/m0/s1 |
| InChIKey | WMGLDZHURAJTMB-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|