C16H24O — CID 102424556
[(E,4R)-4-methyloct-5-enoxy]methylbenzene (PubChem CID 102424556) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is [(E,4R)-4-methyloct-5-enoxy]methylbenzene.
| Compound Name | [(E,4R)-4-methyloct-5-enoxy]methylbenzene |
|---|---|
| PubChem CID | 102424556 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | [(E,4R)-4-methyloct-5-enoxy]methylbenzene |
| SMILES | CC/C=C/[C@H](C)CCCOCc1ccccc1 |
| InChI | InChI=1S/C16H24O/c1-3-4-9-15(2)10-8-13-17-14-16-11-6-5-7-12-16/h4-7,9,11-12,15H,3,8,10,13-14H2,1-2H3/b9-4+/t15-/m0/s1 |
| InChIKey | UQVHXCYZVFZOMB-ULYATVDSSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|