C23H41O6P — CID 138624959
2-[4-(4-diethoxyphosphoryl-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethoxymethylbenzene (PubChem CID 138624959) has the molecular formula C23H41O6P and a molecular weight of 444.55 g/mol. Its IUPAC name is 2-[4-(4-diethoxyphosphoryl-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethoxymethylbenzene.
| Compound Name | 2-[4-(4-diethoxyphosphoryl-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethoxymethylbenzene |
|---|---|
| PubChem CID | 138624959 |
| Molecular Formula | C23H41O6P |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-[4-(4-diethoxyphosphoryl-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethoxymethylbenzene |
| SMILES | CCOP(=O)(CCC(C)(C)OCCC(C)(C)OCCOCc1ccccc1)OCC |
| InChI | InChI=1S/C23H41O6P/c1-7-28-30(24,29-8-2)19-15-23(5,6)26-16-14-22(3,4)27-18-17-25-20-21-12-10-9-11-13-21/h9-13H,7-8,14-20H2,1-6H3 |
| InChIKey | HIAQBKLMBQOUIZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|