C40H52O7P2 — CID 22392102
[[5-[4-bis(phenylmethoxy)phosphoryl-4-methylpentoxy]-2-methylpentan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene (PubChem CID 22392102) has the molecular formula C40H52O7P2 and a molecular weight of 706.80 g/mol. Its IUPAC name is [[5-[4-bis(phenylmethoxy)phosphoryl-4-methylpentoxy]-2-methylpentan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene.
| Compound Name | [[5-[4-bis(phenylmethoxy)phosphoryl-4-methylpentoxy]-2-methylpentan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene |
|---|---|
| PubChem CID | 22392102 |
| Molecular Formula | C40H52O7P2 |
| Molecular Weight | 706.80 g/mol |
| Exact Mass | 706.32 |
| IUPAC Name | [[5-[4-bis(phenylmethoxy)phosphoryl-4-methylpentoxy]-2-methylpentan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene |
| SMILES | CC(C)(CCCOCCCC(C)(C)P(=O)(OCc1ccccc1)OCc1ccccc1)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C40H52O7P2/c1-39(2,48(41,44-31-35-19-9-5-10-20-35)45-32-36-21-11-6-12-22-36)27-17-29-43-30-18-28-40(3,4)49(42,46-33-37-23-13-7-14-24-37)47-34-38-25-15-8-16-26-38/h5-16,19-26H,17-18,27-34H2,1-4H3 |
| InChIKey | GFMRJYGHDRWYOW-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.80 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|