C42H56O7P2 — CID 22392105
[[6-[5-bis(phenylmethoxy)phosphoryl-5-methylhexoxy]-2-methylhexan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene (PubChem CID 22392105) has the molecular formula C42H56O7P2 and a molecular weight of 734.85 g/mol. Its IUPAC name is [[6-[5-bis(phenylmethoxy)phosphoryl-5-methylhexoxy]-2-methylhexan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene.
| Compound Name | [[6-[5-bis(phenylmethoxy)phosphoryl-5-methylhexoxy]-2-methylhexan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene |
|---|---|
| PubChem CID | 22392105 |
| Molecular Formula | C42H56O7P2 |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.35 |
| IUPAC Name | [[6-[5-bis(phenylmethoxy)phosphoryl-5-methylhexoxy]-2-methylhexan-2-yl]-phenylmethoxyphosphoryl]oxymethylbenzene |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)P(=O)(OCc1ccccc1)OCc1ccccc1)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C42H56O7P2/c1-41(2,50(43,46-33-37-21-9-5-10-22-37)47-34-38-23-11-6-12-24-38)29-17-19-31-45-32-20-18-30-42(3,4)51(44,48-35-39-25-13-7-14-26-39)49-36-40-27-15-8-16-28-40/h5-16,21-28H,17-20,29-36H2,1-4H3 |
| InChIKey | WUPPEFFRMFDOBZ-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|