C9H21ClF2NO4P — CID 86678306
2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethanamine;hydrochloride (PubChem CID 86678306) has the molecular formula C9H21ClF2NO4P and a molecular weight of 311.69 g/mol. Its IUPAC name is 2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethanamine;hydrochloride.
| Compound Name | 2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 86678306 |
| Molecular Formula | C9H21ClF2NO4P |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethanamine;hydrochloride |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCOCCN.Cl |
| InChI | InChI=1S/C9H20F2NO4P.ClH/c1-3-15-17(13,16-4-2)9(10,11)5-7-14-8-6-12;/h3-8,12H2,1-2H3;1H |
| InChIKey | HTUYOQRVVPPSTC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|